C15H12ClN3OS — CID 29048022
(2R)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-phenylacetamide (PubChem CID 29048022) has the molecular formula C15H12ClN3OS and a molecular weight of 317.80 g/mol. Its IUPAC name is (2R)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-phenylacetamide.
| Compound Name | (2R)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 29048022 |
| Molecular Formula | C15H12ClN3OS |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (2R)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-2-phenylacetamide |
| SMILES | N[C@@H](C(=O)Nc1nc2ccc(Cl)cc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H12ClN3OS/c16-10-6-7-11-12(8-10)21-15(18-11)19-14(20)13(17)9-4-2-1-3-5-9/h1-8,13H,17H2,(H,18,19,20)/t13-/m1/s1 |
| InChIKey | VGGKOGSKPKCIGK-CYBMUJFWSA-N |
| XLogP | 3.59 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |