C13H16ClN3OS — CID 14285781
(2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-4-methylpentanamide (PubChem CID 14285781) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is (2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-4-methylpentanamide.
| Compound Name | (2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-4-methylpentanamide |
|---|---|
| PubChem CID | 14285781 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (2S)-2-amino-N-(6-chloro-1,3-benzothiazol-2-yl)-4-methylpentanamide |
| SMILES | CC(C)C[C@H](N)C(=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C13H16ClN3OS/c1-7(2)5-9(15)12(18)17-13-16-10-4-3-8(14)6-11(10)19-13/h3-4,6-7,9H,5,15H2,1-2H3,(H,16,17,18)/t9-/m0/s1 |
| InChIKey | WUZWQOYWPBJZRP-VIFPVBQESA-N |
| XLogP | 3.26 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |