C19H14ClN3O3S — CID 7719954
N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 7719954) has the molecular formula C19H14ClN3O3S and a molecular weight of 399.86 g/mol. Its IUPAC name is N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 7719954 |
| Molecular Formula | C19H14ClN3O3S |
| Molecular Weight | 399.86 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | N-(6-chloro-1,3-benzothiazol-2-yl)-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1nc2ccc(Cl)cc2s1 |
| InChI | InChI=1S/C19H14ClN3O3S/c20-11-7-8-14-15(10-11)27-19(21-14)22-16(24)6-3-9-23-17(25)12-4-1-2-5-13(12)18(23)26/h1-2,4-5,7-8,10H,3,6,9H2,(H,21,22,24) |
| InChIKey | WBPNLCANUKCVGF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.86 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|