C19H14ClN3O3S2 — CID 35721990
N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 35721990) has the molecular formula C19H14ClN3O3S2 and a molecular weight of 431.93 g/mol. Its IUPAC name is N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 35721990 |
| Molecular Formula | C19H14ClN3O3S2 |
| Molecular Weight | 431.93 g/mol |
| Exact Mass | 431.02 |
| IUPAC Name | N-[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)Nc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C19H14ClN3O3S2/c20-15-8-7-14(28-15)13-10-27-19(21-13)22-16(24)6-3-9-23-17(25)11-4-1-2-5-12(11)18(23)26/h1-2,4-5,7-8,10H,3,6,9H2,(H,21,22,24) |
| InChIKey | QABWLCDGTUMAMU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.93 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|