C16H14ClN3O3S2 — CID 39754241
N-[4-[[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 39754241) has the molecular formula C16H14ClN3O3S2 and a molecular weight of 395.89 g/mol. Its IUPAC name is N-[4-[[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 39754241 |
| Molecular Formula | C16H14ClN3O3S2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | N-[4-[[4-(5-chlorothiophen-2-yl)-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)Nc1nc(-c2ccc(Cl)s2)cs1 |
| InChI | InChI=1S/C16H14ClN3O3S2/c17-13-6-5-12(25-13)10-9-24-16(19-10)20-14(21)4-1-7-18-15(22)11-3-2-8-23-11/h2-3,5-6,8-9H,1,4,7H2,(H,18,22)(H,19,20,21) |
| InChIKey | ANWYZXIAXLIAPO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|