C23H21N3O3S — CID 4791355
N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide (PubChem CID 4791355) has the molecular formula C23H21N3O3S and a molecular weight of 419.51 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
|---|---|
| PubChem CID | 4791355 |
| Molecular Formula | C23H21N3O3S |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-4-(1,3-dioxoisoindol-2-yl)butanamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)CCCN3C(=O)c4ccccc4C3=O)n2)c1 |
| InChI | InChI=1S/C23H21N3O3S/c1-14-9-10-15(2)18(12-14)19-13-30-23(24-19)25-20(27)8-5-11-26-21(28)16-6-3-4-7-17(16)22(26)29/h3-4,6-7,9-10,12-13H,5,8,11H2,1-2H3,(H,24,25,27) |
| InChIKey | LGISYOSPNMYYCN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|