C24H23N3O3S — CID 19197271
N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 19197271) has the molecular formula C24H23N3O3S and a molecular weight of 433.53 g/mol. Its IUPAC name is N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 19197271 |
| Molecular Formula | C24H23N3O3S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | N-[4-(2,5-dimethylphenyl)-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | Cc1ccc(C)c(-c2csc(NC(=O)C(C(C)C)N3C(=O)c4ccccc4C3=O)n2)c1 |
| InChI | InChI=1S/C24H23N3O3S/c1-13(2)20(27-22(29)16-7-5-6-8-17(16)23(27)30)21(28)26-24-25-19(12-31-24)18-11-14(3)9-10-15(18)4/h5-13,20H,1-4H3,(H,25,26,28) |
| InChIKey | DZXPFEBBHCQAJG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|