C19H22N4O3S — CID 108750668
N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 108750668) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 108750668 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[4-[(dimethylamino)methyl]-1,3-thiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1nc(CN(C)C)cs1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H22N4O3S/c1-11(2)15(16(24)21-19-20-12(10-27-19)9-22(3)4)23-17(25)13-7-5-6-8-14(13)18(23)26/h5-8,10-11,15H,9H2,1-4H3,(H,20,21,24) |
| InChIKey | SCCBEJCRHMEFRP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|