C18H18N4O3S — CID 19228295
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 19228295) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 19228295 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CC(C)C(C(=O)Nc1nnc(C2CC2)s1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H18N4O3S/c1-9(2)13(14(23)19-18-21-20-15(26-18)10-7-8-10)22-16(24)11-5-3-4-6-12(11)17(22)25/h3-6,9-10,13H,7-8H2,1-2H3,(H,19,21,23) |
| InChIKey | SPISTNIVXNVKQS-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|