C23H28N4O3S — CID 108767952
2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 108767952) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 108767952 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-3-methyl-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | CC(C)C(C(=O)Nc1ncc(CN2CCCCC2C)s1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C23H28N4O3S/c1-14(2)19(27-21(29)17-9-4-5-10-18(17)22(27)30)20(28)25-23-24-12-16(31-23)13-26-11-7-6-8-15(26)3/h4-5,9-10,12,14-15,19H,6-8,11,13H2,1-3H3,(H,24,25,28) |
| InChIKey | DCGWVKJLKDWAJS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|