C19H22FN3OS — CID 108767973
(E)-3-(4-fluorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 108767973) has the molecular formula C19H22FN3OS and a molecular weight of 359.47 g/mol. Its IUPAC name is (E)-3-(4-fluorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-fluorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108767973 |
| Molecular Formula | C19H22FN3OS |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (E)-3-(4-fluorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CC1CCCCN1Cc1cnc(NC(=O)/C=C/c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C19H22FN3OS/c1-14-4-2-3-11-23(14)13-17-12-21-19(25-17)22-18(24)10-7-15-5-8-16(20)9-6-15/h5-10,12,14H,2-4,11,13H2,1H3,(H,21,22,24)/b10-7+ |
| InChIKey | LJWNMNMGJDGNML-JXMROGBWSA-N |
| XLogP | 4.31 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|