C26H28ClN3O2S — CID 108767961
(E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 108767961) has the molecular formula C26H28ClN3O2S and a molecular weight of 482.05 g/mol. Its IUPAC name is (E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108767961 |
| Molecular Formula | C26H28ClN3O2S |
| Molecular Weight | 482.05 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | (E)-3-[4-[(2-chlorophenyl)methoxy]phenyl]-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | CC1CCCCN1Cc1cnc(NC(=O)/C=C/c2ccc(OCc3ccccc3Cl)cc2)s1 |
| InChI | InChI=1S/C26H28ClN3O2S/c1-19-6-4-5-15-30(19)17-23-16-28-26(33-23)29-25(31)14-11-20-9-12-22(13-10-20)32-18-21-7-2-3-8-24(21)27/h2-3,7-14,16,19H,4-6,15,17-18H2,1H3,(H,28,29,31)/b14-11+ |
| InChIKey | BVPPATCNXRBUEZ-SDNWHVSQSA-N |
| XLogP | 6.40 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.05 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|