C25H23ClN4O3S — CID 108767954
2-(2-chlorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 108767954) has the molecular formula C25H23ClN4O3S and a molecular weight of 495.00 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-(2-chlorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 108767954 |
| Molecular Formula | C25H23ClN4O3S |
| Molecular Weight | 495.00 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CC1CCCCN1Cc1cnc(NC(=O)c2ccc3c(c2)C(=O)N(c2ccccc2Cl)C3=O)s1 |
| InChI | InChI=1S/C25H23ClN4O3S/c1-15-6-4-5-11-29(15)14-17-13-27-25(34-17)28-22(31)16-9-10-18-19(12-16)24(33)30(23(18)32)21-8-3-2-7-20(21)26/h2-3,7-10,12-13,15H,4-6,11,14H2,1H3,(H,27,28,31) |
| InChIKey | JAUWFYGEBKPOHE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.00 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|