C17H18F3N3OS — CID 108745642
2,3,4-trifluoro-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 108745642) has the molecular formula C17H18F3N3OS and a molecular weight of 369.41 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2,3,4-trifluoro-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 108745642 |
| Molecular Formula | C17H18F3N3OS |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2,3,4-trifluoro-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CC1CCCCN1Cc1cnc(NC(=O)c2ccc(F)c(F)c2F)s1 |
| InChI | InChI=1S/C17H18F3N3OS/c1-10-4-2-3-7-23(10)9-11-8-21-17(25-11)22-16(24)12-5-6-13(18)15(20)14(12)19/h5-6,8,10H,2-4,7,9H2,1H3,(H,21,22,24) |
| InChIKey | YNNHMSOXHWEVPM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|