C25H24N4O3S — CID 108767940
4-(1,3-dioxoisoindol-2-yl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 108767940) has the molecular formula C25H24N4O3S and a molecular weight of 460.56 g/mol. Its IUPAC name is 4-(1,3-dioxoisoindol-2-yl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(1,3-dioxoisoindol-2-yl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 108767940 |
| Molecular Formula | C25H24N4O3S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-(1,3-dioxoisoindol-2-yl)-N-[5-[(2-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CC1CCCCN1Cc1cnc(NC(=O)c2ccc(N3C(=O)c4ccccc4C3=O)cc2)s1 |
| InChI | InChI=1S/C25H24N4O3S/c1-16-6-4-5-13-28(16)15-19-14-26-25(33-19)27-22(30)17-9-11-18(12-10-17)29-23(31)20-7-2-3-8-21(20)24(29)32/h2-3,7-12,14,16H,4-6,13,15H2,1H3,(H,26,27,30) |
| InChIKey | YTBXSMTWWREMJB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|