C24H26N4O5S2 — CID 4139190
N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide (PubChem CID 4139190) has the molecular formula C24H26N4O5S2 and a molecular weight of 514.63 g/mol. Its IUPAC name is N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide.
| Compound Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
|---|---|
| PubChem CID | 4139190 |
| Molecular Formula | C24H26N4O5S2 |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NC(=O)C(C(C)C)N3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C24H26N4O5S2/c1-5-27(6-2)35(32,33)15-11-12-18-19(13-15)34-24(25-18)26-21(29)20(14(3)4)28-22(30)16-9-7-8-10-17(16)23(28)31/h7-14,20H,5-6H2,1-4H3,(H,25,26,29) |
| InChIKey | RJPUJISPNQXZJB-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|