C20H23N3O3S2 — CID 3472361
N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-phenylpropanamide (PubChem CID 3472361) has the molecular formula C20H23N3O3S2 and a molecular weight of 417.56 g/mol. Its IUPAC name is N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-phenylpropanamide.
| Compound Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 3472361 |
| Molecular Formula | C20H23N3O3S2 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | N-[6-(diethylsulfamoyl)-1,3-benzothiazol-2-yl]-3-phenylpropanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nc(NC(=O)CCc3ccccc3)sc2c1 |
| InChI | InChI=1S/C20H23N3O3S2/c1-3-23(4-2)28(25,26)16-11-12-17-18(14-16)27-20(21-17)22-19(24)13-10-15-8-6-5-7-9-15/h5-9,11-12,14H,3-4,10,13H2,1-2H3,(H,21,22,24) |
| InChIKey | INJVFQSKAYKGLB-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |