C12H15N3O3S2 — CID 41232987
N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide (PubChem CID 41232987) has the molecular formula C12H15N3O3S2 and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide.
| Compound Name | N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 41232987 |
| Molecular Formula | C12H15N3O3S2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nc2ccc(S(=O)(=O)N(C)C)cc2s1 |
| InChI | InChI=1S/C12H15N3O3S2/c1-4-11(16)14-12-13-9-6-5-8(7-10(9)19-12)20(17,18)15(2)3/h5-7H,4H2,1-3H3,(H,13,14,16) |
| InChIKey | XIXOEOFQXKRZHU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |