C13H16BrN3O3S2 — CID 5061232
2-bromo-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]butanamide (PubChem CID 5061232) has the molecular formula C13H16BrN3O3S2 and a molecular weight of 406.33 g/mol. Its IUPAC name is 2-bromo-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]butanamide.
| Compound Name | 2-bromo-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 5061232 |
| Molecular Formula | C13H16BrN3O3S2 |
| Molecular Weight | 406.33 g/mol |
| Exact Mass | 404.98 |
| IUPAC Name | 2-bromo-N-[6-(dimethylsulfamoyl)-1,3-benzothiazol-2-yl]butanamide |
| SMILES | CCC(Br)C(=O)Nc1nc2ccc(S(=O)(=O)N(C)C)cc2s1 |
| InChI | InChI=1S/C13H16BrN3O3S2/c1-4-9(14)12(18)16-13-15-10-6-5-8(7-11(10)21-13)22(19,20)17(2)3/h5-7,9H,4H2,1-3H3,(H,15,16,18) |
| InChIKey | KVLFNBWALILXAC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|