C14H18BrN3OS — CID 17244746
2-bromo-N-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pentanamide (PubChem CID 17244746) has the molecular formula C14H18BrN3OS and a molecular weight of 356.29 g/mol. Its IUPAC name is 2-bromo-N-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pentanamide.
| Compound Name | 2-bromo-N-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pentanamide |
|---|---|
| PubChem CID | 17244746 |
| Molecular Formula | C14H18BrN3OS |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 355.04 |
| IUPAC Name | 2-bromo-N-[6-(dimethylamino)-1,3-benzothiazol-2-yl]pentanamide |
| SMILES | CCCC(Br)C(=O)Nc1nc2ccc(N(C)C)cc2s1 |
| InChI | InChI=1S/C14H18BrN3OS/c1-4-5-10(15)13(19)17-14-16-11-7-6-9(18(2)3)8-12(11)20-14/h6-8,10H,4-5H2,1-3H3,(H,16,17,19) |
| InChIKey | CUPDYTPJSWEKCZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|