C20H20BrFN2O2S — CID 28662843
(2R)-2-bromo-N-[6-[(2-fluorophenyl)methoxy]-1,3-benzothiazol-2-yl]hexanamide (PubChem CID 28662843) has the molecular formula C20H20BrFN2O2S and a molecular weight of 451.36 g/mol. Its IUPAC name is (2R)-2-bromo-N-[6-[(2-fluorophenyl)methoxy]-1,3-benzothiazol-2-yl]hexanamide.
| Compound Name | (2R)-2-bromo-N-[6-[(2-fluorophenyl)methoxy]-1,3-benzothiazol-2-yl]hexanamide |
|---|---|
| PubChem CID | 28662843 |
| Molecular Formula | C20H20BrFN2O2S |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | (2R)-2-bromo-N-[6-[(2-fluorophenyl)methoxy]-1,3-benzothiazol-2-yl]hexanamide |
| SMILES | CCCC[C@@H](Br)C(=O)Nc1nc2ccc(OCc3ccccc3F)cc2s1 |
| InChI | InChI=1S/C20H20BrFN2O2S/c1-2-3-7-15(21)19(25)24-20-23-17-10-9-14(11-18(17)27-20)26-12-13-6-4-5-8-16(13)22/h4-6,8-11,15H,2-3,7,12H2,1H3,(H,23,24,25)/t15-/m1/s1 |
| InChIKey | ATZZPWPRBGJCKK-OAHLLOKOSA-N |
| XLogP | 5.91 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|