C16H19BrN2O3S — CID 17244792
ethyl 2-(2-bromohexanoylamino)-1,3-benzothiazole-6-carboxylate (PubChem CID 17244792) has the molecular formula C16H19BrN2O3S and a molecular weight of 399.31 g/mol. Its IUPAC name is ethyl 2-(2-bromohexanoylamino)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(2-bromohexanoylamino)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17244792 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | ethyl 2-(2-bromohexanoylamino)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCC(Br)C(=O)Nc1nc2ccc(C(=O)OCC)cc2s1 |
| InChI | InChI=1S/C16H19BrN2O3S/c1-3-5-6-11(17)14(20)19-16-18-12-8-7-10(9-13(12)23-16)15(21)22-4-2/h7-9,11H,3-6H2,1-2H3,(H,18,19,20) |
| InChIKey | HTDQVTKNVBWWNF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|