C20H21BrN2O2S — CID 28662840
(2S)-2-bromo-N-(6-phenylmethoxy-1,3-benzothiazol-2-yl)hexanamide (PubChem CID 28662840) has the molecular formula C20H21BrN2O2S and a molecular weight of 433.37 g/mol. Its IUPAC name is (2S)-2-bromo-N-(6-phenylmethoxy-1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | (2S)-2-bromo-N-(6-phenylmethoxy-1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 28662840 |
| Molecular Formula | C20H21BrN2O2S |
| Molecular Weight | 433.37 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | (2S)-2-bromo-N-(6-phenylmethoxy-1,3-benzothiazol-2-yl)hexanamide |
| SMILES | CCCC[C@H](Br)C(=O)Nc1nc2ccc(OCc3ccccc3)cc2s1 |
| InChI | InChI=1S/C20H21BrN2O2S/c1-2-3-9-16(21)19(24)23-20-22-17-11-10-15(12-18(17)26-20)25-13-14-7-5-4-6-8-14/h4-8,10-12,16H,2-3,9,13H2,1H3,(H,22,23,24)/t16-/m0/s1 |
| InChIKey | URFHNVYUSCEAPY-INIZCTEOSA-N |
| XLogP | 5.77 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.37 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|