C26H26N2O3S — CID 19219498
N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(4-phenylphenoxy)propanamide (PubChem CID 19219498) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(4-phenylphenoxy)propanamide.
| Compound Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(4-phenylphenoxy)propanamide |
|---|---|
| PubChem CID | 19219498 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-2-(4-phenylphenoxy)propanamide |
| SMILES | CCCCOc1ccc2nc(NC(=O)C(C)Oc3ccc(-c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C26H26N2O3S/c1-3-4-16-30-22-14-15-23-24(17-22)32-26(27-23)28-25(29)18(2)31-21-12-10-20(11-13-21)19-8-6-5-7-9-19/h5-15,17-18H,3-4,16H2,1-2H3,(H,27,28,29) |
| InChIKey | IHFQVUUWTRZFQX-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|