C22H21N3O4S — CID 19219051
N-(6-butoxy-1,3-benzothiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide (PubChem CID 19219051) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is N-(6-butoxy-1,3-benzothiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide.
| Compound Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
|---|---|
| PubChem CID | 19219051 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | N-(6-butoxy-1,3-benzothiazol-2-yl)-3-(1,3-dioxoisoindol-2-yl)propanamide |
| SMILES | CCCCOc1ccc2nc(NC(=O)CCN3C(=O)c4ccccc4C3=O)sc2c1 |
| InChI | InChI=1S/C22H21N3O4S/c1-2-3-12-29-14-8-9-17-18(13-14)30-22(23-17)24-19(26)10-11-25-20(27)15-6-4-5-7-16(15)21(25)28/h4-9,13H,2-3,10-12H2,1H3,(H,23,24,26) |
| InChIKey | AIGIUNINZGGKRS-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|