C23H21N3O3S3 — CID 18854278
N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide (PubChem CID 18854278) has the molecular formula C23H21N3O3S3 and a molecular weight of 483.64 g/mol. Its IUPAC name is N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 18854278 |
| Molecular Formula | C23H21N3O3S3 |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | N-(6-ethoxy-1,3-benzothiazol-2-yl)-3-[(5Z)-5-[(4-methylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanamide |
| SMILES | CCOc1ccc2nc(NC(=O)CCN3C(=O)/C(=C/c4ccc(C)cc4)SC3=S)sc2c1 |
| InChI | InChI=1S/C23H21N3O3S3/c1-3-29-16-8-9-17-18(13-16)31-22(24-17)25-20(27)10-11-26-21(28)19(32-23(26)30)12-15-6-4-14(2)5-7-15/h4-9,12-13H,3,10-11H2,1-2H3,(H,24,25,27)/b19-12- |
| InChIKey | LZZCINNDTYODTE-UNOMPAQXSA-N |
| XLogP | 5.23 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|