C22H19N3O2S3 — CID 18854117
4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 18854117) has the molecular formula C22H19N3O2S3 and a molecular weight of 453.61 g/mol. Its IUPAC name is 4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 18854117 |
| Molecular Formula | C22H19N3O2S3 |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 4-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-methyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | Cc1ccc2nc(NC(=O)CCCN3C(=O)/C(=C/c4ccccc4)SC3=S)sc2c1 |
| InChI | InChI=1S/C22H19N3O2S3/c1-14-9-10-16-17(12-14)29-21(23-16)24-19(26)8-5-11-25-20(27)18(30-22(25)28)13-15-6-3-2-4-7-15/h2-4,6-7,9-10,12-13H,5,8,11H2,1H3,(H,23,24,26)/b18-13- |
| InChIKey | BGINDIQLCJCPIB-AQTBWJFISA-N |
| XLogP | 5.22 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|