C19H15N3O2S4 — CID 18854113
N-(6-methyl-1,3-benzothiazol-2-yl)-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide (PubChem CID 18854113) has the molecular formula C19H15N3O2S4 and a molecular weight of 445.62 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 18854113 |
| Molecular Formula | C19H15N3O2S4 |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 445.00 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-3-[(5Z)-4-oxo-2-sulfanylidene-5-(thiophen-2-ylmethylidene)-1,3-thiazolidin-3-yl]propanamide |
| SMILES | Cc1ccc2nc(NC(=O)CCN3C(=O)/C(=C/c4cccs4)SC3=S)sc2c1 |
| InChI | InChI=1S/C19H15N3O2S4/c1-11-4-5-13-14(9-11)27-18(20-13)21-16(23)6-7-22-17(24)15(28-19(22)25)10-12-3-2-8-26-12/h2-5,8-10H,6-7H2,1H3,(H,20,21,23)/b15-10- |
| InChIKey | IHEMIVFINLXYPJ-GDNBJRDFSA-N |
| XLogP | 4.90 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|