C15H15N3O3S — CID 18126296
3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 18126296) has the molecular formula C15H15N3O3S and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 18126296 |
| Molecular Formula | C15H15N3O3S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 3-(2,5-dioxopyrrolidin-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | Cc1ccc2nc(NC(=O)CCN3C(=O)CCC3=O)sc2c1 |
| InChI | InChI=1S/C15H15N3O3S/c1-9-2-3-10-11(8-9)22-15(16-10)17-12(19)6-7-18-13(20)4-5-14(18)21/h2-3,8H,4-7H2,1H3,(H,16,17,19) |
| InChIKey | VSZLKCSOLIPPNJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|