C16H21N3O2S — CID 59725477
N-(6-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbutanamide (PubChem CID 59725477) has the molecular formula C16H21N3O2S and a molecular weight of 319.43 g/mol. Its IUPAC name is N-(6-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbutanamide.
| Compound Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbutanamide |
|---|---|
| PubChem CID | 59725477 |
| Molecular Formula | C16H21N3O2S |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-(6-methyl-1,3-benzothiazol-2-yl)-4-morpholin-4-ylbutanamide |
| SMILES | Cc1ccc2nc(NC(=O)CCCN3CCOCC3)sc2c1 |
| InChI | InChI=1S/C16H21N3O2S/c1-12-4-5-13-14(11-12)22-16(17-13)18-15(20)3-2-6-19-7-9-21-10-8-19/h4-5,11H,2-3,6-10H2,1H3,(H,17,18,20) |
| InChIKey | MFULZXCVTWUBAX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |