C15H15IN4OS — CID 19549923
3-(4-iodo-3-methylpyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 19549923) has the molecular formula C15H15IN4OS and a molecular weight of 426.28 g/mol. Its IUPAC name is 3-(4-iodo-3-methylpyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | 3-(4-iodo-3-methylpyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 19549923 |
| Molecular Formula | C15H15IN4OS |
| Molecular Weight | 426.28 g/mol |
| Exact Mass | 426.00 |
| IUPAC Name | 3-(4-iodo-3-methylpyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | Cc1ccc2nc(NC(=O)CCn3cc(I)c(C)n3)sc2c1 |
| InChI | InChI=1S/C15H15IN4OS/c1-9-3-4-12-13(7-9)22-15(17-12)18-14(21)5-6-20-8-11(16)10(2)19-20/h3-4,7-8H,5-6H2,1-2H3,(H,17,18,21) |
| InChIKey | RDSMVNJOSJEHCO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.28 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|