C19H12FN3O2S3 — CID 18854157
2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 18854157) has the molecular formula C19H12FN3O2S3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18854157 |
| Molecular Formula | C19H12FN3O2S3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | 2-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccccc2)SC1=S)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H12FN3O2S3/c20-12-6-7-13-14(9-12)27-18(21-13)22-16(24)10-23-17(25)15(28-19(23)26)8-11-4-2-1-3-5-11/h1-9H,10H2,(H,21,22,24)/b15-8- |
| InChIKey | YWLSKNVSHBVKON-NVNXTCNLSA-N |
| XLogP | 4.28 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|