C21H17N3O2S3 — CID 2893837
N-(1,3-benzothiazol-2-yl)-2-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 2893837) has the molecular formula C21H17N3O2S3 and a molecular weight of 439.59 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 2893837 |
| Molecular Formula | C21H17N3O2S3 |
| Molecular Weight | 439.59 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[5-[(4-ethylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | CCc1ccc(C=C2SC(=S)N(CC(=O)Nc3nc4ccccc4s3)C2=O)cc1 |
| InChI | InChI=1S/C21H17N3O2S3/c1-2-13-7-9-14(10-8-13)11-17-19(26)24(21(27)29-17)12-18(25)23-20-22-15-5-3-4-6-16(15)28-20/h3-11H,2,12H2,1H3,(H,22,23,25) |
| InChIKey | SGTCGIPUSZNWRO-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|