C19H11F2N3O2S3 — CID 18854163
N-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide (PubChem CID 18854163) has the molecular formula C19H11F2N3O2S3 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 18854163 |
| Molecular Formula | C19H11F2N3O2S3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.00 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-2-[(5Z)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C/c2ccc(F)cc2)SC1=S)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C19H11F2N3O2S3/c20-11-3-1-10(2-4-11)7-15-17(26)24(19(27)29-15)9-16(25)23-18-22-13-6-5-12(21)8-14(13)28-18/h1-8H,9H2,(H,22,23,25)/b15-7- |
| InChIKey | NFQAWZITZKRGOJ-CHHVJCJISA-N |
| XLogP | 4.41 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|