C19H14N4O5S2 — CID 108742114
4-(5-nitro-1,3-dioxoisoindol-2-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide (PubChem CID 108742114) has the molecular formula C19H14N4O5S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is 4-(5-nitro-1,3-dioxoisoindol-2-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide.
| Compound Name | 4-(5-nitro-1,3-dioxoisoindol-2-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 108742114 |
| Molecular Formula | C19H14N4O5S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.04 |
| IUPAC Name | 4-(5-nitro-1,3-dioxoisoindol-2-yl)-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)butanamide |
| SMILES | O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C19H14N4O5S2/c24-16(21-19-20-14(10-30-19)15-3-2-8-29-15)4-1-7-22-17(25)12-6-5-11(23(27)28)9-13(12)18(22)26/h2-3,5-6,8-10H,1,4,7H2,(H,20,21,24) |
| InChIKey | WDPHQZHKFGRHTL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 122.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|