C24H19N5O6 — CID 108925199
N-[3-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]pyridine-3-carboxamide (PubChem CID 108925199) has the molecular formula C24H19N5O6 and a molecular weight of 473.45 g/mol. Its IUPAC name is N-[3-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]pyridine-3-carboxamide.
| Compound Name | N-[3-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 108925199 |
| Molecular Formula | C24H19N5O6 |
| Molecular Weight | 473.45 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[3-[4-(5-nitro-1,3-dioxoisoindol-2-yl)butanoylamino]phenyl]pyridine-3-carboxamide |
| SMILES | O=C(CCCN1C(=O)c2ccc([N+](=O)[O-])cc2C1=O)Nc1cccc(NC(=O)c2cccnc2)c1 |
| InChI | InChI=1S/C24H19N5O6/c30-21(26-16-5-1-6-17(12-16)27-22(31)15-4-2-10-25-14-15)7-3-11-28-23(32)19-9-8-18(29(34)35)13-20(19)24(28)33/h1-2,4-6,8-10,12-14H,3,7,11H2,(H,26,30)(H,27,31) |
| InChIKey | MGHQSDVLVBYTIO-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|