C25H29N3O5 — CID 3354332
11-(1,3-dioxoisoindol-2-yl)-N-(3-nitrophenyl)undecanamide (PubChem CID 3354332) has the molecular formula C25H29N3O5 and a molecular weight of 451.52 g/mol. Its IUPAC name is 11-(1,3-dioxoisoindol-2-yl)-N-(3-nitrophenyl)undecanamide.
| Compound Name | 11-(1,3-dioxoisoindol-2-yl)-N-(3-nitrophenyl)undecanamide |
|---|---|
| PubChem CID | 3354332 |
| Molecular Formula | C25H29N3O5 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.21 |
| IUPAC Name | 11-(1,3-dioxoisoindol-2-yl)-N-(3-nitrophenyl)undecanamide |
| SMILES | O=C(CCCCCCCCCCN1C(=O)c2ccccc2C1=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H29N3O5/c29-23(26-19-12-11-13-20(18-19)28(32)33)16-7-5-3-1-2-4-6-10-17-27-24(30)21-14-8-9-15-22(21)25(27)31/h8-9,11-15,18H,1-7,10,16-17H2,(H,26,29) |
| InChIKey | YJSXRQZTARXABM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|