C15H17N3O4S2 — CID 9410980
N-(3-nitrophenyl)-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide (PubChem CID 9410980) has the molecular formula C15H17N3O4S2 and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(3-nitrophenyl)-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide.
| Compound Name | N-(3-nitrophenyl)-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide |
|---|---|
| PubChem CID | 9410980 |
| Molecular Formula | C15H17N3O4S2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-(3-nitrophenyl)-6-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)hexanamide |
| SMILES | O=C(CCCCCN1C(=O)CSC1=S)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H17N3O4S2/c19-13(16-11-5-4-6-12(9-11)18(21)22)7-2-1-3-8-17-14(20)10-24-15(17)23/h4-6,9H,1-3,7-8,10H2,(H,16,19) |
| InChIKey | KLJKWVJRHUPTRJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|