C15H16N2O4S2 — CID 9313892
N-(1,3-benzodioxol-5-yl)-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide (PubChem CID 9313892) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 9313892 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-5-(4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)pentanamide |
| SMILES | O=C(CCCCN1C(=O)CSC1=S)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H16N2O4S2/c18-13(3-1-2-6-17-14(19)8-23-15(17)22)16-10-4-5-11-12(7-10)21-9-20-11/h4-5,7H,1-3,6,8-9H2,(H,16,18) |
| InChIKey | WJZMYUJUKKKSQQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|