C17H12N3O6- — CID 7375552
2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-nitrophenolate (PubChem CID 7375552) has the molecular formula C17H12N3O6- and a molecular weight of 354.30 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-nitrophenolate.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-nitrophenolate |
|---|---|
| PubChem CID | 7375552 |
| Molecular Formula | C17H12N3O6- |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-nitrophenolate |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)Nc1cc([N+](=O)[O-])ccc1[O-] |
| InChI | InChI=1S/C17H13N3O6/c21-14-6-5-10(20(25)26)9-13(14)18-15(22)7-8-19-16(23)11-3-1-2-4-12(11)17(19)24/h1-6,9,21H,7-8H2,(H,18,22)/p-1 |
| InChIKey | FFYHNMNKZRAJPY-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|