C19H16N3O6- — CID 7308211
2-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-nitrophenolate (PubChem CID 7308211) has the molecular formula C19H16N3O6- and a molecular weight of 382.35 g/mol. Its IUPAC name is 2-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-nitrophenolate.
| Compound Name | 2-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-nitrophenolate |
|---|---|
| PubChem CID | 7308211 |
| Molecular Formula | C19H16N3O6- |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 2-[[2-(2-methylpropyl)-1,3-dioxoisoindole-5-carbonyl]amino]-4-nitrophenolate |
| SMILES | CC(C)CN1C(=O)c2ccc(C(=O)Nc3cc([N+](=O)[O-])ccc3[O-])cc2C1=O |
| InChI | InChI=1S/C19H17N3O6/c1-10(2)9-21-18(25)13-5-3-11(7-14(13)19(21)26)17(24)20-15-8-12(22(27)28)4-6-16(15)23/h3-8,10,23H,9H2,1-2H3,(H,20,24)/p-1 |
| InChIKey | MMTODQJNBUCEIV-UHFFFAOYSA-M |
| XLogP | 2.17 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|