C17H14N4O6 — CID 19258999
1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(2-methoxy-5-nitrophenyl)urea (PubChem CID 19258999) has the molecular formula C17H14N4O6 and a molecular weight of 370.32 g/mol. Its IUPAC name is 1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(2-methoxy-5-nitrophenyl)urea.
| Compound Name | 1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(2-methoxy-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 19258999 |
| Molecular Formula | C17H14N4O6 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-[(1,3-dioxoisoindol-2-yl)methyl]-3-(2-methoxy-5-nitrophenyl)urea |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)NCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H14N4O6/c1-27-14-7-6-10(21(25)26)8-13(14)19-17(24)18-9-20-15(22)11-4-2-3-5-12(11)16(20)23/h2-8H,9H2,1H3,(H2,18,19,24) |
| InChIKey | IUJNOTOZSWXICR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|