C11H13N3O7 — CID 66165701
2-hydroxy-3-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanoic acid (PubChem CID 66165701) has the molecular formula C11H13N3O7 and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-hydroxy-3-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanoic acid.
| Compound Name | 2-hydroxy-3-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 66165701 |
| Molecular Formula | C11H13N3O7 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-hydroxy-3-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)NCC(O)C(=O)O |
| InChI | InChI=1S/C11H13N3O7/c1-21-9-3-2-6(14(19)20)4-7(9)13-11(18)12-5-8(15)10(16)17/h2-4,8,15H,5H2,1H3,(H,16,17)(H2,12,13,18) |
| InChIKey | LIYAMSSMNVMXAD-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 151.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|