C13H17FN4O5 — CID 122157662
N-(2-fluoroethyl)-2-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanamide (PubChem CID 122157662) has the molecular formula C13H17FN4O5 and a molecular weight of 328.30 g/mol. Its IUPAC name is N-(2-fluoroethyl)-2-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanamide.
| Compound Name | N-(2-fluoroethyl)-2-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanamide |
|---|---|
| PubChem CID | 122157662 |
| Molecular Formula | C13H17FN4O5 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-(2-fluoroethyl)-2-[(2-methoxy-5-nitrophenyl)carbamoylamino]propanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)NC(C)C(=O)NCCF |
| InChI | InChI=1S/C13H17FN4O5/c1-8(12(19)15-6-5-14)16-13(20)17-10-7-9(18(21)22)3-4-11(10)23-2/h3-4,7-8H,5-6H2,1-2H3,(H,15,19)(H2,16,17,20) |
| InChIKey | YBWVIDXJRUTTEW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|