C16H16FN3O5 — CID 47031754
1-[2-(4-fluorophenoxy)ethyl]-3-(2-methoxy-5-nitrophenyl)urea (PubChem CID 47031754) has the molecular formula C16H16FN3O5 and a molecular weight of 349.32 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethyl]-3-(2-methoxy-5-nitrophenyl)urea.
| Compound Name | 1-[2-(4-fluorophenoxy)ethyl]-3-(2-methoxy-5-nitrophenyl)urea |
|---|---|
| PubChem CID | 47031754 |
| Molecular Formula | C16H16FN3O5 |
| Molecular Weight | 349.32 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethyl]-3-(2-methoxy-5-nitrophenyl)urea |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)NCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C16H16FN3O5/c1-24-15-7-4-12(20(22)23)10-14(15)19-16(21)18-8-9-25-13-5-2-11(17)3-6-13/h2-7,10H,8-9H2,1H3,(H2,18,19,21) |
| InChIKey | VRFOTDVIIAGVJM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|