C24H19N3O5S — CID 19318834
N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-nitrobenzamide (PubChem CID 19318834) has the molecular formula C24H19N3O5S and a molecular weight of 461.50 g/mol. Its IUPAC name is N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19318834 |
| Molecular Formula | C24H19N3O5S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | N-[3-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-nitrobenzamide |
| SMILES | O=C(Nc1cccc(SCCCN2C(=O)c3ccccc3C2=O)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H19N3O5S/c28-22(16-6-3-8-18(14-16)27(31)32)25-17-7-4-9-19(15-17)33-13-5-12-26-23(29)20-10-1-2-11-21(20)24(26)30/h1-4,6-11,14-15H,5,12-13H2,(H,25,28) |
| InChIKey | DXIWDTRPRHNSSI-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|