C29H19N3O6S — CID 19298485
N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide (PubChem CID 19298485) has the molecular formula C29H19N3O6S and a molecular weight of 537.55 g/mol. Its IUPAC name is N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide.
| Compound Name | N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 19298485 |
| Molecular Formula | C29H19N3O6S |
| Molecular Weight | 537.55 g/mol |
| Exact Mass | 537.10 |
| IUPAC Name | N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-3-nitrobenzamide |
| SMILES | O=C(CSc1cccc(NC(=O)c2cccc([N+](=O)[O-])c2)c1)Nc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C29H19N3O6S/c33-25(31-24-13-5-12-23-26(24)28(35)22-11-2-1-10-21(22)27(23)34)16-39-20-9-4-7-18(15-20)30-29(36)17-6-3-8-19(14-17)32(37)38/h1-15H,16H2,(H,30,36)(H,31,33) |
| InChIKey | KYFCNEMOXAZDMP-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|