C30H22N2O4S — CID 19298845
N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide (PubChem CID 19298845) has the molecular formula C30H22N2O4S and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide.
| Compound Name | N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 19298845 |
| Molecular Formula | C30H22N2O4S |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | N-[3-[2-[(9,10-dioxoanthracen-1-yl)amino]-2-oxoethyl]sulfanylphenyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)Nc1cccc(SCC(=O)Nc2cccc3c2C(=O)c2ccccc2C3=O)c1 |
| InChI | InChI=1S/C30H22N2O4S/c1-18-8-2-3-11-21(18)30(36)31-19-9-6-10-20(16-19)37-17-26(33)32-25-15-7-14-24-27(25)29(35)23-13-5-4-12-22(23)28(24)34/h2-16H,17H2,1H3,(H,31,36)(H,32,33) |
| InChIKey | NZGAWDADTWFZIN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|