C24H22N2O4S — CID 18906521
methyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 18906521) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is methyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 18906521 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | methyl 2-[[2-[3-[(2-methylbenzoyl)amino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1cccc(NC(=O)c2ccccc2C)c1 |
| InChI | InChI=1S/C24H22N2O4S/c1-16-8-3-4-11-19(16)23(28)25-17-9-7-10-18(14-17)31-15-22(27)26-21-13-6-5-12-20(21)24(29)30-2/h3-14H,15H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | ZCTMCXIPVCSBQA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |