C24H23N3O3S2 — CID 19316658
methyl 2-[[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 19316658) has the molecular formula C24H23N3O3S2 and a molecular weight of 465.60 g/mol. Its IUPAC name is methyl 2-[[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | methyl 2-[[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 19316658 |
| Molecular Formula | C24H23N3O3S2 |
| Molecular Weight | 465.60 g/mol |
| Exact Mass | 465.12 |
| IUPAC Name | methyl 2-[[2-[3-[(4-methylphenyl)carbamothioylamino]phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CSc1cccc(NC(=S)Nc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H23N3O3S2/c1-16-10-12-17(13-11-16)25-24(31)26-18-6-5-7-19(14-18)32-15-22(28)27-21-9-4-3-8-20(21)23(29)30-2/h3-14H,15H2,1-2H3,(H,27,28)(H2,25,26,31) |
| InChIKey | KSFYAIFNWZWFJV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.60 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|